C18H25N2O4+ — CID 7272364
2-[(2R)-3-acetyl-2-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]ethyl-(2-hydroxyethyl)azanium (PubChem CID 7272364) has the molecular formula C18H25N2O4+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[(2R)-3-acetyl-2-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]ethyl-(2-hydroxyethyl)azanium.
| Compound Name | 2-[(2R)-3-acetyl-2-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7272364 |
| Molecular Formula | C18H25N2O4+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[(2R)-3-acetyl-2-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]ethyl-(2-hydroxyethyl)azanium |
| SMILES | CCc1ccc([C@@H]2C(C(C)=O)=C(O)C(=O)N2CC[NH2+]CCO)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-3-13-4-6-14(7-5-13)16-15(12(2)22)17(23)18(24)20(16)10-8-19-9-11-21/h4-7,16,19,21,23H,3,8-11H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | OLEREBSNYDHQJC-MRXNPFEDSA-O |
| XLogP | 0.09 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|