C14H13NO2 — CID 72723683
4-methyl-2-phenyl-6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 72723683) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-methyl-2-phenyl-6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 4-methyl-2-phenyl-6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 72723683 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-methyl-2-phenyl-6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CC1=C2C(=O)N(c3ccccc3)C(=O)C2CC1 |
| InChI | InChI=1S/C14H13NO2/c1-9-7-8-11-12(9)14(17)15(13(11)16)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | PARNBHXIFJDWRX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|