C11H8N4O2 — CID 72723870
8-methyl-1,4-dihydropyrazino[2,3-f]quinoxaline-2,3-dione (PubChem CID 72723870) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 8-methyl-1,4-dihydropyrazino[2,3-f]quinoxaline-2,3-dione.
| Compound Name | 8-methyl-1,4-dihydropyrazino[2,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 72723870 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8-methyl-1,4-dihydropyrazino[2,3-f]quinoxaline-2,3-dione |
| SMILES | Cc1cnc2c(ccc3[nH]c(=O)c(=O)[nH]c32)n1 |
| InChI | InChI=1S/C11H8N4O2/c1-5-4-12-8-6(13-5)2-3-7-9(8)15-11(17)10(16)14-7/h2-4H,1H3,(H,14,16)(H,15,17) |
| InChIKey | OHCZHHAAEBZEBF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|