C12H16N3O+ — CID 7272388
1-(2-ethenoxyethyl)-3-methylbenzimidazol-3-ium-2-amine (PubChem CID 7272388) has the molecular formula C12H16N3O+ and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-(2-ethenoxyethyl)-3-methylbenzimidazol-3-ium-2-amine.
| Compound Name | 1-(2-ethenoxyethyl)-3-methylbenzimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 7272388 |
| Molecular Formula | C12H16N3O+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(2-ethenoxyethyl)-3-methylbenzimidazol-3-ium-2-amine |
| SMILES | C=COCCn1c(N)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C12H15N3O/c1-3-16-9-8-15-11-7-5-4-6-10(11)14(2)12(15)13/h3-7,13H,1,8-9H2,2H3/p+1 |
| InChIKey | GLXBONLCGIVTMJ-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 44.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|