C10H14O4 — CID 72723979
(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-10-ene (PubChem CID 72723979) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-10-ene.
| Compound Name | (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-10-ene |
|---|---|
| PubChem CID | 72723979 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-10-ene |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CC=CO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C10H14O4/c1-10(2)13-8-7-6(4-3-5-11-7)12-9(8)14-10/h3,5-9H,4H2,1-2H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | HUTUPZYXBONXCE-BZNPZCIMSA-N |
| XLogP | 1.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |