About 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one
2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 72724048) has the molecular formula C17H13N3O
and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one |
| PubChem CID | 72724048 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2cccc3cnccc23)Nc2ccccc21 |
| InChI | InChI=1S/C17H13N3O/c21-17-14-5-1-2-7-15(14)19-16(20-17)13-6-3-4-11-10-18-9-8-12(11)13/h1-10,16,19H,(H,20,21) |
| InChIKey | WVEGFXCKWRWQND-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one?
The IUPAC name of 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one (CID 72724048) is 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one.
What is the SMILES notation for 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one?
The canonical SMILES for 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one is O=C1NC(c2cccc3cnccc23)Nc2ccccc21.
What is the InChIKey of 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one?
The InChIKey is WVEGFXCKWRWQND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O/c21-17-14-5-1-2-7-15(14)19-16(20-17)13-6-3-4-11-10-18-9-8-12(11)13/h1-10,16,19H,(H,20,21).
What are the key properties of 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one?
2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one has a molecular weight of 275.31 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoquinolin-5-yl-2,3-dihydro-1H-quinazolin-4-one is sourced from PubChem (CID 72724048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).