C39H39BN2O6 — CID 72724322
methyl 4-[5,11-diethyl-2,2-bis(4-formylphenoxy)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate (PubChem CID 72724322) has the molecular formula C39H39BN2O6 and a molecular weight of 642.56 g/mol. Its IUPAC name is methyl 4-[5,11-diethyl-2,2-bis(4-formylphenoxy)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate.
| Compound Name | methyl 4-[5,11-diethyl-2,2-bis(4-formylphenoxy)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
|---|---|
| PubChem CID | 72724322 |
| Molecular Formula | C39H39BN2O6 |
| Molecular Weight | 642.56 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | methyl 4-[5,11-diethyl-2,2-bis(4-formylphenoxy)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
| SMILES | CCC1=C(C)C2=C(c3ccc(C(=O)OC)cc3)c3c(C)c(CC)c(C)n3[B-](Oc3ccc(C=O)cc3)(Oc3ccc(C=O)cc3)[N+]2=C1C |
| InChI | InChI=1S/C39H39BN2O6/c1-8-34-24(3)37-36(30-14-16-31(17-15-30)39(45)46-7)38-25(4)35(9-2)27(6)42(38)40(41(37)26(34)5,47-32-18-10-28(22-43)11-19-32)48-33-20-12-29(23-44)13-21-33/h10-23H,8-9H2,1-7H3 |
| InChIKey | RXKWYADYRZCGPH-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|