C16H19ClN2O2 — CID 72724656
N-[(5S,7S,8aR)-5-(4-chlorophenyl)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]acetamide (PubChem CID 72724656) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is N-[(5S,7S,8aR)-5-(4-chlorophenyl)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]acetamide.
| Compound Name | N-[(5S,7S,8aR)-5-(4-chlorophenyl)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]acetamide |
|---|---|
| PubChem CID | 72724656 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-[(5S,7S,8aR)-5-(4-chlorophenyl)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@H]2CCC(=O)N2[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-10(20)18-13-8-14-6-7-16(21)19(14)15(9-13)11-2-4-12(17)5-3-11/h2-5,13-15H,6-9H2,1H3,(H,18,20)/t13-,14+,15-/m0/s1 |
| InChIKey | WKHVJBBNEJSGPQ-ZNMIVQPWSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |