C14H13F3N2O4S2 — CID 72724688
4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide (PubChem CID 72724688) has the molecular formula C14H13F3N2O4S2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide.
| Compound Name | 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 72724688 |
| Molecular Formula | C14H13F3N2O4S2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N(CC(F)(F)F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13F3N2O4S2/c15-14(16,17)10-19(25(22,23)13-4-2-1-3-5-13)11-6-8-12(9-7-11)24(18,20)21/h1-9H,10H2,(H2,18,20,21) |
| InChIKey | MHENAGZWIDWQRK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |