C17H15F6N3OS — CID 72724760
[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-[3-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 72724760) has the molecular formula C17H15F6N3OS and a molecular weight of 423.38 g/mol. Its IUPAC name is [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-[3-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-[3-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 72724760 |
| Molecular Formula | C17H15F6N3OS |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-[3-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CS/C(N)=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F6N3OS/c1-10-13(25-6-5-14(10)27-9-16(18,19)20)8-28-15(24)26-12-4-2-3-11(7-12)17(21,22)23/h2-7H,8-9H2,1H3,(H2,24,26) |
| InChIKey | IMEMSVAJLFENQH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|