About 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol
2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol (PubChem CID 72724831) has the molecular formula C14H12F3N5O
and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol |
| PubChem CID | 72724831 |
| Molecular Formula | C14H12F3N5O |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol |
| SMILES | OCCNc1cc(-c2n[nH]c3cnccc23)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N5O/c15-14(16,17)12-6-8(19-3-4-23)5-10(20-12)13-9-1-2-18-7-11(9)21-22-13/h1-2,5-7,23H,3-4H2,(H,19,20)(H,21,22) |
| InChIKey | CNTAIQDCYAEVFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol?
The IUPAC name of 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol (CID 72724831) is 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol.
What is the SMILES notation for 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol?
The canonical SMILES for 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol is OCCNc1cc(-c2n[nH]c3cnccc23)nc(C(F)(F)F)c1.
What is the InChIKey of 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol?
The InChIKey is CNTAIQDCYAEVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N5O/c15-14(16,17)12-6-8(19-3-4-23)5-10(20-12)13-9-1-2-18-7-11(9)21-22-13/h1-2,5-7,23H,3-4H2,(H,19,20)(H,21,22).
What are the key properties of 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol?
2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol has a molecular weight of 323.28 g/mol, XLogP of 2.44, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1H-pyrazolo[5,4-c]pyridin-3-yl)-6-(trifluoromethyl)-4-pyridinyl]amino]ethanol is sourced from PubChem (CID 72724831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).