C15H9ClN4O — CID 72725112
11-(4-chlorophenyl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 72725112) has the molecular formula C15H9ClN4O and a molecular weight of 296.72 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11-(4-chlorophenyl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 72725112 |
| Molecular Formula | C15H9ClN4O |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 11-(4-chlorophenyl)-8-oxa-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1oc1cc(-c3ccc(Cl)cc3)cnc12 |
| InChI | InChI=1S/C15H9ClN4O/c16-10-3-1-8(2-4-10)9-5-11-12(18-6-9)13-14(21-11)15(17)20-7-19-13/h1-7H,(H2,17,19,20) |
| InChIKey | SDXKHRCEGUNLQS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |