C31H29NO2 — CID 72725128
(3S,4S,5R)-3-[(dibenzylamino)methyl]-4,5-diphenyloxolan-2-one (PubChem CID 72725128) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(dibenzylamino)methyl]-4,5-diphenyloxolan-2-one.
| Compound Name | (3S,4S,5R)-3-[(dibenzylamino)methyl]-4,5-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 72725128 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (3S,4S,5R)-3-[(dibenzylamino)methyl]-4,5-diphenyloxolan-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@H](c2ccccc2)[C@H]1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H29NO2/c33-31-28(23-32(21-24-13-5-1-6-14-24)22-25-15-7-2-8-16-25)29(26-17-9-3-10-18-26)30(34-31)27-19-11-4-12-20-27/h1-20,28-30H,21-23H2/t28-,29-,30+/m1/s1 |
| InChIKey | VYVYDXHUNHPZNN-OCBJUFRSSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |