C26H27N5O4 — CID 72725140
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(3E)-3-[(1-methylimidazol-2-yl)methylidene]-2-oxo-1H-indol-5-yl]acetamide (PubChem CID 72725140) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(3E)-3-[(1-methylimidazol-2-yl)methylidene]-2-oxo-1H-indol-5-yl]acetamide.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(3E)-3-[(1-methylimidazol-2-yl)methylidene]-2-oxo-1H-indol-5-yl]acetamide |
|---|---|
| PubChem CID | 72725140 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(3E)-3-[(1-methylimidazol-2-yl)methylidene]-2-oxo-1H-indol-5-yl]acetamide |
| SMILES | COc1cc2c(cc1OC)CN(CC(=O)Nc1ccc3c(c1)/C(=C\c1nccn1C)C(=O)N3)CC2 |
| InChI | InChI=1S/C26H27N5O4/c1-30-9-7-27-24(30)13-20-19-12-18(4-5-21(19)29-26(20)33)28-25(32)15-31-8-6-16-10-22(34-2)23(35-3)11-17(16)14-31/h4-5,7,9-13H,6,8,14-15H2,1-3H3,(H,28,32)(H,29,33)/b20-13+ |
| InChIKey | UXBRVJKDXOQYFD-DEDYPNTBSA-N |
| XLogP | 2.93 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|