About 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid
5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid (PubChem CID 72725256) has the molecular formula C26H31F2NO4
and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid.
Molecular Properties
| Compound Name | 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid |
| PubChem CID | 72725256 |
| Molecular Formula | C26H31F2NO4 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid |
| SMILES | CC1CCC(C(=O)N(c2ccc(Oc3ccccc3C(C)(F)F)cc2C(=O)O)C(C)C)CC1 |
| InChI | InChI=1S/C26H31F2NO4/c1-16(2)29(24(30)18-11-9-17(3)10-12-18)22-14-13-19(15-20(22)25(31)32)33-23-8-6-5-7-21(23)26(4,27)28/h5-8,13-18H,9-12H2,1-4H3,(H,31,32) |
| InChIKey | FDVUHTFLDYXMEI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid?
The IUPAC name of 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid (CID 72725256) is 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid.
What is the SMILES notation for 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid?
The canonical SMILES for 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid is CC1CCC(C(=O)N(c2ccc(Oc3ccccc3C(C)(F)F)cc2C(=O)O)C(C)C)CC1.
What is the InChIKey of 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid?
The InChIKey is FDVUHTFLDYXMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31F2NO4/c1-16(2)29(24(30)18-11-9-17(3)10-12-18)22-14-13-19(15-20(22)25(31)32)33-23-8-6-5-7-21(23)26(4,27)28/h5-8,13-18H,9-12H2,1-4H3,(H,31,32).
What are the key properties of 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid?
5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid has a molecular weight of 459.53 g/mol, XLogP of 6.86, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,1-difluoroethyl)phenoxy]-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid is sourced from PubChem (CID 72725256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).