About (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 7272538) has the molecular formula C4H6N2O2S
and a molecular weight of 146.17 g/mol. Its IUPAC name is (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 7272538 |
| Molecular Formula | C4H6N2O2S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | NC1=N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C4H6N2O2S/c5-4-6-2(1-9-4)3(7)8/h2H,1H2,(H2,5,6)(H,7,8)/t2-/m0/s1 |
| InChIKey | VHPXSBIFWDAFMB-REOHCLBHSA-N |
| XLogP | -0.50 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CID 7272538) is (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid is NC1=N[C@H](C(=O)O)CS1.
What is the InChIKey of (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is VHPXSBIFWDAFMB-REOHCLBHSA-N. The full InChI is InChI=1S/C4H6N2O2S/c5-4-6-2(1-9-4)3(7)8/h2H,1H2,(H2,5,6)(H,7,8)/t2-/m0/s1.
What are the key properties of (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
(4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 146.17 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-amino-4,5-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 7272538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).