C34H41N5O2 — CID 72725438
N-(5-nitro-1,2,3,4-tetrahydroacridin-9-yl)-N'-(1,2,3,4-tetrahydroacridin-9-yl)octane-1,8-diamine (PubChem CID 72725438) has the molecular formula C34H41N5O2 and a molecular weight of 551.74 g/mol. Its IUPAC name is N-(5-nitro-1,2,3,4-tetrahydroacridin-9-yl)-N'-(1,2,3,4-tetrahydroacridin-9-yl)octane-1,8-diamine.
| Compound Name | N-(5-nitro-1,2,3,4-tetrahydroacridin-9-yl)-N'-(1,2,3,4-tetrahydroacridin-9-yl)octane-1,8-diamine |
|---|---|
| PubChem CID | 72725438 |
| Molecular Formula | C34H41N5O2 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | N-(5-nitro-1,2,3,4-tetrahydroacridin-9-yl)-N'-(1,2,3,4-tetrahydroacridin-9-yl)octane-1,8-diamine |
| SMILES | O=[N+]([O-])c1cccc2c(NCCCCCCCCNc3c4c(nc5ccccc35)CCCC4)c3c(nc12)CCCC3 |
| InChI | InChI=1S/C34H41N5O2/c40-39(41)31-21-13-17-27-33(26-16-7-10-20-30(26)38-34(27)31)36-23-12-4-2-1-3-11-22-35-32-24-14-5-8-18-28(24)37-29-19-9-6-15-25(29)32/h5,8,13-14,17-18,21H,1-4,6-7,9-12,15-16,19-20,22-23H2,(H,35,37)(H,36,38) |
| InChIKey | DMTOWVUOHDLGGK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|