C17H18N4O4S — CID 72725593
4-(5-ethoxycarbonyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 72725593) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-(5-ethoxycarbonyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-(5-ethoxycarbonyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 72725593 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-(5-ethoxycarbonyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1c([O-])on[n+]1-c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-4-24-15(22)12-10(3)18-17(26)19-13(12)14-16(23)25-20-21(14)11-7-5-9(2)6-8-11/h5-8,13H,4H2,1-3H3,(H2-,18,19,20,22,23,26) |
| InChIKey | IJOKKUNQGRXYJS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|