About [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate
[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate (PubChem CID 72725670) has the molecular formula C16H15F4N3OS
and a molecular weight of 373.38 g/mol. Its IUPAC name is [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate.
Molecular Properties
| Compound Name | [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate |
| PubChem CID | 72725670 |
| Molecular Formula | C16H15F4N3OS |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CS/C(N)=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15F4N3OS/c1-10-13(22-7-6-14(10)24-9-16(18,19)20)8-25-15(21)23-12-4-2-11(17)3-5-12/h2-7H,8-9H2,1H3,(H2,21,23) |
| InChIKey | DXWWSZVRKONADD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate?
The IUPAC name of [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate (CID 72725670) is [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate.
What is the SMILES notation for [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate?
The canonical SMILES for [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate is Cc1c(OCC(F)(F)F)ccnc1CS/C(N)=N/c1ccc(F)cc1.
What is the InChIKey of [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate?
The InChIKey is DXWWSZVRKONADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F4N3OS/c1-10-13(22-7-6-14(10)24-9-16(18,19)20)8-25-15(21)23-12-4-2-11(17)3-5-12/h2-7H,8-9H2,1H3,(H2,21,23).
What are the key properties of [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate?
[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate has a molecular weight of 373.38 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N'-(4-fluorophenyl)carbamimidothioate is sourced from PubChem (CID 72725670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).