C31H28N4O3 — CID 72725806
2-[3-[(2S,4R)-6-carbamimidoyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-2-yl]phenyl]-5-carbamoylbenzoic acid (PubChem CID 72725806) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[3-[(2S,4R)-6-carbamimidoyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-2-yl]phenyl]-5-carbamoylbenzoic acid.
| Compound Name | 2-[3-[(2S,4R)-6-carbamimidoyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-2-yl]phenyl]-5-carbamoylbenzoic acid |
|---|---|
| PubChem CID | 72725806 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-[3-[(2S,4R)-6-carbamimidoyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-2-yl]phenyl]-5-carbamoylbenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)[C@@](C)(c1ccccc1)C[C@@H](c1cccc(-c3ccc(C(N)=O)cc3C(=O)O)c1)N2 |
| InChI | InChI=1S/C31H28N4O3/c1-31(22-8-3-2-4-9-22)17-27(35-26-13-11-20(28(32)33)16-25(26)31)19-7-5-6-18(14-19)23-12-10-21(29(34)36)15-24(23)30(37)38/h2-16,27,35H,17H2,1H3,(H3,32,33)(H2,34,36)(H,37,38)/t27-,31+/m0/s1 |
| InChIKey | DPAVVGLNAXECAW-JTSJOTPCSA-N |
| XLogP | 5.30 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|