C17H19N7O — CID 72725813
4-[3-(4-amino-1,3,5-triazin-2-yl)-2-(ethylamino)benzimidazol-5-yl]-2-methylbut-3-yn-2-ol (PubChem CID 72725813) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[3-(4-amino-1,3,5-triazin-2-yl)-2-(ethylamino)benzimidazol-5-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-(4-amino-1,3,5-triazin-2-yl)-2-(ethylamino)benzimidazol-5-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 72725813 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[3-(4-amino-1,3,5-triazin-2-yl)-2-(ethylamino)benzimidazol-5-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CCNc1nc2ccc(C#CC(C)(C)O)cc2n1-c1ncnc(N)n1 |
| InChI | InChI=1S/C17H19N7O/c1-4-19-15-22-12-6-5-11(7-8-17(2,3)25)9-13(12)24(15)16-21-10-20-14(18)23-16/h5-6,9-10,25H,4H2,1-3H3,(H,19,22)(H2,18,20,21,23) |
| InChIKey | NDZPPXQOOUNQTQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|