C16H19ClN4O2 — CID 72726258
10-(4-chlorophenyl)-1,4a,5,5a,6,7,8,9,9a,10a-decahydrobenzo[g]pteridine-2,4-dione (PubChem CID 72726258) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-1,4a,5,5a,6,7,8,9,9a,10a-decahydrobenzo[g]pteridine-2,4-dione.
| Compound Name | 10-(4-chlorophenyl)-1,4a,5,5a,6,7,8,9,9a,10a-decahydrobenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 72726258 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 10-(4-chlorophenyl)-1,4a,5,5a,6,7,8,9,9a,10a-decahydrobenzo[g]pteridine-2,4-dione |
| SMILES | O=C1NC(=O)C2NC3CCCCC3N(c3ccc(Cl)cc3)C2N1 |
| InChI | InChI=1S/C16H19ClN4O2/c17-9-5-7-10(8-6-9)21-12-4-2-1-3-11(12)18-13-14(21)19-16(23)20-15(13)22/h5-8,11-14,18H,1-4H2,(H2,19,20,22,23) |
| InChIKey | IHUXPTIISOQUAR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |