About 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan
3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan (PubChem CID 72726849) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan.
Molecular Properties
| Compound Name | 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan |
| PubChem CID | 72726849 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan |
| SMILES | C=C1CCCC(C)(C)C1CCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C20H30O/c1-16(7-5-9-18-12-14-21-15-18)10-11-19-17(2)8-6-13-20(19,3)4/h7,12,14-15,19H,2,5-6,8-11,13H2,1,3-4H3 |
| InChIKey | KBXKFFRFDVAEGH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan?
The IUPAC name of 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan (CID 72726849) is 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan.
What is the SMILES notation for 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan?
The canonical SMILES for 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan is C=C1CCCC(C)(C)C1CCC(C)=CCCc1ccoc1.
What is the InChIKey of 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan?
The InChIKey is KBXKFFRFDVAEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O/c1-16(7-5-9-18-12-14-21-15-18)10-11-19-17(2)8-6-13-20(19,3)4/h7,12,14-15,19H,2,5-6,8-11,13H2,1,3-4H3.
What are the key properties of 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan?
3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan has a molecular weight of 286.46 g/mol, XLogP of 6.32, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]furan is sourced from PubChem (CID 72726849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).