N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride

C5H9ClN2O2S — CID 72727035

IUPACN-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride
SMILESCN1CCCC1=NS(=O)(=O)Cl
InChIInChI=1S/C5H9ClN2O2S/c1-8-4-2-3-5(8)7-11(6,9)10/h2-4H2,1H3
InChIKeyQSMLXEQIUHLYAM-UHFFFAOYSA-N
MW196.66 g/mol
LogP0.59
Rot. Bonds1

About N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride

N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride (PubChem CID 72727035) has the molecular formula C5H9ClN2O2S and a molecular weight of 196.66 g/mol. Its IUPAC name is N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride.

Molecular Properties

Compound NameN-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride
PubChem CID72727035
Molecular FormulaC5H9ClN2O2S
Molecular Weight196.66 g/mol
Exact Mass196.01
IUPAC NameN-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride
SMILESCN1CCCC1=NS(=O)(=O)Cl
InChIInChI=1S/C5H9ClN2O2S/c1-8-4-2-3-5(8)7-11(6,9)10/h2-4H2,1H3
InChIKeyQSMLXEQIUHLYAM-UHFFFAOYSA-N
XLogP0.59
TPSA49.74 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.66
LogP ≤ 50.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride?
The IUPAC name of N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride (CID 72727035) is N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride.
What is the SMILES notation for N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride?
The canonical SMILES for N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride is CN1CCCC1=NS(=O)(=O)Cl.
What is the InChIKey of N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride?
The InChIKey is QSMLXEQIUHLYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClN2O2S/c1-8-4-2-3-5(8)7-11(6,9)10/h2-4H2,1H3.
What are the key properties of N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride?
N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride has a molecular weight of 196.66 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylpyrrolidin-2-ylidene)sulfamoyl chloride is sourced from PubChem (CID 72727035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).