About 3,5-dimethyl-4aH-quinazoline-2,4-dione
3,5-dimethyl-4aH-quinazoline-2,4-dione (PubChem CID 72727203) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 3,5-dimethyl-4aH-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3,5-dimethyl-4aH-quinazoline-2,4-dione |
| PubChem CID | 72727203 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3,5-dimethyl-4aH-quinazoline-2,4-dione |
| SMILES | CC1=CC=CC2=NC(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C10H10N2O2/c1-6-4-3-5-7-8(6)9(13)12(2)10(14)11-7/h3-5,8H,1-2H3 |
| InChIKey | ZEUWWQKOBAXEAI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-4aH-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4aH-quinazoline-2,4-dione?
The IUPAC name of 3,5-dimethyl-4aH-quinazoline-2,4-dione (CID 72727203) is 3,5-dimethyl-4aH-quinazoline-2,4-dione.
What is the SMILES notation for 3,5-dimethyl-4aH-quinazoline-2,4-dione?
The canonical SMILES for 3,5-dimethyl-4aH-quinazoline-2,4-dione is CC1=CC=CC2=NC(=O)N(C)C(=O)C12.
What is the InChIKey of 3,5-dimethyl-4aH-quinazoline-2,4-dione?
The InChIKey is ZEUWWQKOBAXEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-4-3-5-7-8(6)9(13)12(2)10(14)11-7/h3-5,8H,1-2H3.
What are the key properties of 3,5-dimethyl-4aH-quinazoline-2,4-dione?
3,5-dimethyl-4aH-quinazoline-2,4-dione has a molecular weight of 190.20 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4aH-quinazoline-2,4-dione is sourced from PubChem (CID 72727203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).