C15H24O2 — CID 72727439
3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxirane-2-carbaldehyde (PubChem CID 72727439) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxirane-2-carbaldehyde.
| Compound Name | 3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 72727439 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxirane-2-carbaldehyde |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)OC1C=O |
| InChI | InChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-15(4)14(11-16)17-15/h7,9,11,14H,5-6,8,10H2,1-4H3 |
| InChIKey | JGVHFKXHMXWLAM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|