About 4-iminopent-2-en-2-amine
4-iminopent-2-en-2-amine (PubChem CID 72728882) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 4-iminopent-2-en-2-amine.
Molecular Properties
| Compound Name | 4-iminopent-2-en-2-amine |
| PubChem CID | 72728882 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 4-iminopent-2-en-2-amine |
| SMILES | [H]/N=C(\C)C=C(C)N |
| InChI | InChI=1S/C5H10N2/c1-4(6)3-5(2)7/h3,6H,7H2,1-2H3/b5-3?,6-4+ |
| InChIKey | URFRUNCMRYDMIA-QEKUZXLOSA-N |
| XLogP | 0.89 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminopent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminopent-2-en-2-amine?
The IUPAC name of 4-iminopent-2-en-2-amine (CID 72728882) is 4-iminopent-2-en-2-amine.
What is the SMILES notation for 4-iminopent-2-en-2-amine?
The canonical SMILES for 4-iminopent-2-en-2-amine is [H]/N=C(\C)C=C(C)N.
What is the InChIKey of 4-iminopent-2-en-2-amine?
The InChIKey is URFRUNCMRYDMIA-QEKUZXLOSA-N. The full InChI is InChI=1S/C5H10N2/c1-4(6)3-5(2)7/h3,6H,7H2,1-2H3/b5-3?,6-4+.
What are the key properties of 4-iminopent-2-en-2-amine?
4-iminopent-2-en-2-amine has a molecular weight of 98.15 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminopent-2-en-2-amine is sourced from PubChem (CID 72728882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).