C22H23F3IN3O2 — CID 72728982
2,2,2-trifluoroethyl 2-(2-anilinoethenyl)-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 72728982) has the molecular formula C22H23F3IN3O2 and a molecular weight of 545.34 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(2-anilinoethenyl)-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide.
| Compound Name | 2,2,2-trifluoroethyl 2-(2-anilinoethenyl)-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 72728982 |
| Molecular Formula | C22H23F3IN3O2 |
| Molecular Weight | 545.34 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(2-anilinoethenyl)-1,3-diethylbenzimidazol-1-ium-5-carboxylate iodide |
| SMILES | CCn1c(C=CNc2ccccc2)[n+](CC)c2ccc(C(=O)OCC(F)(F)F)cc21.[I-] |
| InChI | InChI=1S/C22H22F3N3O2.HI/c1-3-27-18-11-10-16(21(29)30-15-22(23,24)25)14-19(18)28(4-2)20(27)12-13-26-17-8-6-5-7-9-17;/h5-14H,3-4,15H2,1-2H3;1H |
| InChIKey | YGHBAGYXPANGKL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|