C21H28N6O2 — CID 7272952
3-[(S)-azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 7272952) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-[(S)-azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 7272952 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[(S)-azepan-1-yl-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | COCCn1nnnc1[C@H](c1cc2cccc(C)c2[nH]c1=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H28N6O2/c1-15-8-7-9-16-14-17(21(28)22-18(15)16)19(26-10-5-3-4-6-11-26)20-23-24-25-27(20)12-13-29-2/h7-9,14,19H,3-6,10-13H2,1-2H3,(H,22,28)/t19-/m0/s1 |
| InChIKey | BEFQADASXDAHNL-IBGZPJMESA-N |
| XLogP | 2.43 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |