About N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine
N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine (PubChem CID 72730029) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine |
| PubChem CID | 72730029 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine |
| SMILES | CCN1CCC=C(C(C)=NO)C1 |
| InChI | InChI=1S/C9H16N2O/c1-3-11-6-4-5-9(7-11)8(2)10-12/h5,12H,3-4,6-7H2,1-2H3 |
| InChIKey | GVOMNNIJLVYOHK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine?
The IUPAC name of N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine (CID 72730029) is N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine.
What is the SMILES notation for N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine?
The canonical SMILES for N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine is CCN1CCC=C(C(C)=NO)C1.
What is the InChIKey of N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine?
The InChIKey is GVOMNNIJLVYOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-3-11-6-4-5-9(7-11)8(2)10-12/h5,12H,3-4,6-7H2,1-2H3.
What are the key properties of N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine?
N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine has a molecular weight of 168.24 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)ethylidene]hydroxylamine is sourced from PubChem (CID 72730029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).