About 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one
1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one (PubChem CID 72731315) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one |
| PubChem CID | 72731315 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one |
| SMILES | CCCCCC=CC=CC(=O)N1C=CCCC1 |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h6-7,9-10,12-13H,2-5,8,11,14H2,1H3 |
| InChIKey | XONHEUHVKZYWGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one?
The IUPAC name of 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one (CID 72731315) is 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one?
The canonical SMILES for 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one is CCCCCC=CC=CC(=O)N1C=CCCC1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one?
The InChIKey is XONHEUHVKZYWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h6-7,9-10,12-13H,2-5,8,11,14H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one?
1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one has a molecular weight of 233.36 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4-dien-1-one is sourced from PubChem (CID 72731315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).