About magnesium;N,N-dimethylaniline;bromide
magnesium;N,N-dimethylaniline;bromide (PubChem CID 72731801) has the molecular formula C8H10BrMgN
and a molecular weight of 224.38 g/mol. Its IUPAC name is magnesium;N,N-dimethylaniline;bromide.
Molecular Properties
| Compound Name | magnesium;N,N-dimethylaniline;bromide |
| PubChem CID | 72731801 |
| Molecular Formula | C8H10BrMgN |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | magnesium;N,N-dimethylaniline;bromide |
| SMILES | CN(C)c1[c-]cccc1.[Br-].[Mg+2] |
| InChI | InChI=1S/C8H10N.BrH.Mg/c1-9(2)8-6-4-3-5-7-8;;/h3-6H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | FBKCXBKIMKAXOI-UHFFFAOYSA-M |
| XLogP | -1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;N,N-dimethylaniline;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;N,N-dimethylaniline;bromide?
The IUPAC name of magnesium;N,N-dimethylaniline;bromide (CID 72731801) is magnesium;N,N-dimethylaniline;bromide.
What is the SMILES notation for magnesium;N,N-dimethylaniline;bromide?
The canonical SMILES for magnesium;N,N-dimethylaniline;bromide is CN(C)c1[c-]cccc1.[Br-].[Mg+2].
What is the InChIKey of magnesium;N,N-dimethylaniline;bromide?
The InChIKey is FBKCXBKIMKAXOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N.BrH.Mg/c1-9(2)8-6-4-3-5-7-8;;/h3-6H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;N,N-dimethylaniline;bromide?
magnesium;N,N-dimethylaniline;bromide has a molecular weight of 224.38 g/mol, XLogP of -1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;N,N-dimethylaniline;bromide is sourced from PubChem (CID 72731801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).