C9H4N4O2 — CID 72733938
2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9-pentaene-4,11-dione (PubChem CID 72733938) has the molecular formula C9H4N4O2 and a molecular weight of 200.16 g/mol. Its IUPAC name is 2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9-pentaene-4,11-dione.
| Compound Name | 2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9-pentaene-4,11-dione |
|---|---|
| PubChem CID | 72733938 |
| Molecular Formula | C9H4N4O2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9-pentaene-4,11-dione |
| SMILES | O=C1N=C2C=CC=C3C(=O)N=NC(=N1)C32 |
| InChI | InChI=1S/C9H4N4O2/c14-8-4-2-1-3-5-6(4)7(12-13-8)11-9(15)10-5/h1-3,6H |
| InChIKey | TXBQFGCYVQEENN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |