About trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate
trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate (PubChem CID 72734858) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate |
| PubChem CID | 72734858 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H22O3/c1-5-20-16(19)14-10-13(14)15(18)11-6-8-12(9-7-11)17(2,3)4/h6-9,13-14H,5,10H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | ICPPAZJJTURTTJ-ZIAGYGMSSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate?
The IUPAC name of trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate (CID 72734858) is trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate is CCOC(=O)[C@@H]1C[C@H]1C(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate?
The InChIKey is ICPPAZJJTURTTJ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H22O3/c1-5-20-16(19)14-10-13(14)15(18)11-6-8-12(9-7-11)17(2,3)4/h6-9,13-14H,5,10H2,1-4H3/t13-,14-/m1/s1.
What are the key properties of trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate?
trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate has a molecular weight of 274.36 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1R,2R)-2-(4-tert-butylbenzoyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 72734858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).