About (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene
(20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene (PubChem CID 72734909) has the molecular formula C22H38S4
and a molecular weight of 430.81 g/mol. Its IUPAC name is (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene.
Molecular Properties
| Compound Name | (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene |
| PubChem CID | 72734909 |
| Molecular Formula | C22H38S4 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene |
| SMILES | C1=C/CCCCC2(CCCC3(CCCCC/1)SCCCS3)SCCCS2 |
| InChI | InChI=1S/C22H38S4/c1-2-4-6-8-13-21(23-17-11-18-24-21)15-10-16-22(14-9-7-5-3-1)25-19-12-20-26-22/h1-2H,3-20H2/b2-1+ |
| InChIKey | XPGZHHHWIINCMI-OWOJBTEDSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene?
The IUPAC name of (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene (CID 72734909) is (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene.
What is the SMILES notation for (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene?
The canonical SMILES for (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene is C1=C/CCCCC2(CCCC3(CCCCC/1)SCCCS3)SCCCS2.
What is the InChIKey of (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene?
The InChIKey is XPGZHHHWIINCMI-OWOJBTEDSA-N. The full InChI is InChI=1S/C22H38S4/c1-2-4-6-8-13-21(23-17-11-18-24-21)15-10-16-22(14-9-7-5-3-1)25-19-12-20-26-22/h1-2H,3-20H2/b2-1+.
What are the key properties of (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene?
(20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene has a molecular weight of 430.81 g/mol, XLogP of 8.37, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (20E)-1,5,11,15-tetrathiadispiro[5.3.510.116]hexacos-20-ene is sourced from PubChem (CID 72734909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).