C26H21NO5S — CID 72735973
4-[benzyl-(4-phenoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 72735973) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is 4-[benzyl-(4-phenoxyphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[benzyl-(4-phenoxyphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 72735973 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-[benzyl-(4-phenoxyphenyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H21NO5S/c28-26(29)21-11-17-25(18-12-21)33(30,31)27(19-20-7-3-1-4-8-20)22-13-15-24(16-14-22)32-23-9-5-2-6-10-23/h1-18H,19H2,(H,28,29) |
| InChIKey | RBXZDUYZCZMSQY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |