C16H18O6 — CID 72736137
dimethyl (1S,4R,5S,6R)-3-(2-ethoxy-2-oxoethylidene)tetracyclo[3.3.0.02,8.04,6]octane-1,5-dicarboxylate (PubChem CID 72736137) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is dimethyl (1S,4R,5S,6R)-3-(2-ethoxy-2-oxoethylidene)tetracyclo[3.3.0.02,8.04,6]octane-1,5-dicarboxylate.
| Compound Name | dimethyl (1S,4R,5S,6R)-3-(2-ethoxy-2-oxoethylidene)tetracyclo[3.3.0.02,8.04,6]octane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 72736137 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | dimethyl (1S,4R,5S,6R)-3-(2-ethoxy-2-oxoethylidene)tetracyclo[3.3.0.02,8.04,6]octane-1,5-dicarboxylate |
| SMILES | CCOC(=O)/C=C1/C2C3C[C@@H]4[C@H]1[C@]4(C(=O)OC)[C@]32C(=O)OC |
| InChI | InChI=1S/C16H18O6/c1-4-22-10(17)5-7-11-8-6-9-12(7)16(9,14(19)21-3)15(8,11)13(18)20-2/h5,8-9,11-12H,4,6H2,1-3H3/b7-5-/t8?,9-,11?,12+,15-,16-/m1/s1 |
| InChIKey | KXYONULIRKHUNR-FKWUKYCISA-N |
| XLogP | 0.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|