2-[(2,5-dichlorobenzoyl)amino]acetic acid

C9H7Cl2NO3 — CID 72736430

IUPAC2-[(2,5-dichlorobenzoyl)amino]acetic acid
SMILESO=C(O)CN[14C](=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)/i9+2
InChIKeyHKUAUZSWGMQPOK-FOQJRBATSA-N
MW250.06 g/mol
LogP1.81
Rot. Bonds3

About 2-[(2,5-dichlorobenzoyl)amino]acetic acid

2-[(2,5-dichlorobenzoyl)amino]acetic acid (PubChem CID 72736430) has the molecular formula C9H7Cl2NO3 and a molecular weight of 250.06 g/mol. Its IUPAC name is 2-[(2,5-dichlorobenzoyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2,5-dichlorobenzoyl)amino]acetic acid
PubChem CID72736430
Molecular FormulaC9H7Cl2NO3
Molecular Weight250.06 g/mol
Exact Mass248.98
IUPAC Name2-[(2,5-dichlorobenzoyl)amino]acetic acid
SMILESO=C(O)CN[14C](=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)/i9+2
InChIKeyHKUAUZSWGMQPOK-FOQJRBATSA-N
XLogP1.81
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.06
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,5-dichlorobenzoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dichlorobenzoyl)amino]acetic acid?
The IUPAC name of 2-[(2,5-dichlorobenzoyl)amino]acetic acid (CID 72736430) is 2-[(2,5-dichlorobenzoyl)amino]acetic acid.
What is the SMILES notation for 2-[(2,5-dichlorobenzoyl)amino]acetic acid?
The canonical SMILES for 2-[(2,5-dichlorobenzoyl)amino]acetic acid is O=C(O)CN[14C](=O)c1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[(2,5-dichlorobenzoyl)amino]acetic acid?
The InChIKey is HKUAUZSWGMQPOK-FOQJRBATSA-N. The full InChI is InChI=1S/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)/i9+2.
What are the key properties of 2-[(2,5-dichlorobenzoyl)amino]acetic acid?
2-[(2,5-dichlorobenzoyl)amino]acetic acid has a molecular weight of 250.06 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichlorobenzoyl)amino]acetic acid is sourced from PubChem (CID 72736430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).