C33H28BrN2PS — CID 72736542
[2-methyl-1-[(E)-3-naphthalen-2-ylprop-2-enyl]imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane bromide (PubChem CID 72736542) has the molecular formula C33H28BrN2PS and a molecular weight of 595.55 g/mol. Its IUPAC name is [2-methyl-1-[(E)-3-naphthalen-2-ylprop-2-enyl]imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane bromide.
| Compound Name | [2-methyl-1-[(E)-3-naphthalen-2-ylprop-2-enyl]imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane bromide |
|---|---|
| PubChem CID | 72736542 |
| Molecular Formula | C33H28BrN2PS |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | [2-methyl-1-[(E)-3-naphthalen-2-ylprop-2-enyl]imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane bromide |
| SMILES | Cc1c(P(=S)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C/C=C/c1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C33H28N2PS.BrH/c1-26-33(36(37,30-16-4-2-5-17-30)31-18-6-3-7-19-31)35-23-11-10-20-32(35)34(26)24-12-13-27-21-22-28-14-8-9-15-29(28)25-27;/h2-23,25H,24H2,1H3;1H/q+1;/p-1/b13-12+; |
| InChIKey | DMRUTZUETLGBIJ-UEIGIMKUSA-M |
| XLogP | 3.16 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|