C16H16O5 — CID 72736691
methyl (1R,9R,13S)-12-acetyl-11-methyl-8,10-dioxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-13-carboxylate (PubChem CID 72736691) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl (1R,9R,13S)-12-acetyl-11-methyl-8,10-dioxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-13-carboxylate.
| Compound Name | methyl (1R,9R,13S)-12-acetyl-11-methyl-8,10-dioxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 72736691 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl (1R,9R,13S)-12-acetyl-11-methyl-8,10-dioxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-13-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2OC(C)=C(C(C)=O)[C@H]1c1ccccc1O2 |
| InChI | InChI=1S/C16H16O5/c1-8(17)12-9(2)20-16-14(15(18)19-3)13(12)10-6-4-5-7-11(10)21-16/h4-7,13-14,16H,1-3H3/t13-,14-,16-/m1/s1 |
| InChIKey | BZUQOUSSMPTPAT-IIAWOOMASA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |