C17H28NO5PS — CID 72736964
N-[(Z)-1-diethoxyphosphorylprop-1-enyl]-4-methyl-N-propylbenzenesulfonamide (PubChem CID 72736964) has the molecular formula C17H28NO5PS and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[(Z)-1-diethoxyphosphorylprop-1-enyl]-4-methyl-N-propylbenzenesulfonamide.
| Compound Name | N-[(Z)-1-diethoxyphosphorylprop-1-enyl]-4-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 72736964 |
| Molecular Formula | C17H28NO5PS |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(Z)-1-diethoxyphosphorylprop-1-enyl]-4-methyl-N-propylbenzenesulfonamide |
| SMILES | C/C=C(/N(CCC)S(=O)(=O)c1ccc(C)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H28NO5PS/c1-6-14-18(17(7-2)24(19,22-8-3)23-9-4)25(20,21)16-12-10-15(5)11-13-16/h7,10-13H,6,8-9,14H2,1-5H3/b17-7- |
| InChIKey | YPJUTAMWOOKKOT-IDUWFGFVSA-N |
| XLogP | 4.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|