C21H35NO8 — CID 72736988
1-O,2-O-ditert-butyl 4-O-methyl (2S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2,4-tricarboxylate (PubChem CID 72736988) has the molecular formula C21H35NO8 and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-O,2-O-ditert-butyl 4-O-methyl (2S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-ditert-butyl 4-O-methyl (2S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 72736988 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-O,2-O-ditert-butyl 4-O-methyl (2S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidine-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H35NO8/c1-19(2,3)29-17(24)13-10-12(16(23)26-9)15(14-11-27-21(7,8)28-14)22(13)18(25)30-20(4,5)6/h12-15H,10-11H2,1-9H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | QMRPGMPRRLWQIJ-BYNSBNAKSA-N |
| XLogP | 2.65 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|