C13H12ClN3S2 — CID 72737031
2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)-1-benzothiophen-5-amine;hydrochloride (PubChem CID 72737031) has the molecular formula C13H12ClN3S2 and a molecular weight of 309.85 g/mol. Its IUPAC name is 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)-1-benzothiophen-5-amine;hydrochloride.
| Compound Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)-1-benzothiophen-5-amine;hydrochloride |
|---|---|
| PubChem CID | 72737031 |
| Molecular Formula | C13H12ClN3S2 |
| Molecular Weight | 309.85 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)-1-benzothiophen-5-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2sc(C3CN4C=CSC4=N3)cc2c1 |
| InChI | InChI=1S/C13H11N3S2.ClH/c14-9-1-2-11-8(5-9)6-12(18-11)10-7-16-3-4-17-13(16)15-10;/h1-6,10H,7,14H2;1H |
| InChIKey | AAYUGJSPDGFFSN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|