About CID 72737113
CID 72737113 (PubChem CID 72737113) has the molecular formula C33H38N7O2
and a molecular weight of 564.71 g/mol.
Molecular Properties
| Compound Name | CID 72737113 |
| PubChem CID | 72737113 |
| Molecular Formula | C33H38N7O2 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | — |
| SMILES | C/C(=N\NC1=Nc2ccccc2C2Nc3ccc(C(=O)NC4CC(C)(C)N([O])C(C)(C)C4)cc3C2C1)c1ccccn1 |
| InChI | InChI=1S/C33H38N7O2/c1-20(26-11-8-9-15-34-26)38-39-29-17-25-24-16-21(31(41)35-22-18-32(2,3)40(42)33(4,5)19-22)13-14-28(24)37-30(25)23-10-6-7-12-27(23)36-29/h6-16,22,25,30,37H,17-19H2,1-5H3,(H,35,41)(H,36,39)/b38-20+ |
| InChIKey | BEQWBADWZZJCCI-CHSHITCJSA-N |
| XLogP | 5.88 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 72737113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72737113?
The IUPAC name of CID 72737113 (CID 72737113) is not available.
What is the SMILES notation for CID 72737113?
The canonical SMILES for CID 72737113 is C/C(=N\NC1=Nc2ccccc2C2Nc3ccc(C(=O)NC4CC(C)(C)N([O])C(C)(C)C4)cc3C2C1)c1ccccn1.
What is the InChIKey of CID 72737113?
The InChIKey is BEQWBADWZZJCCI-CHSHITCJSA-N. The full InChI is InChI=1S/C33H38N7O2/c1-20(26-11-8-9-15-34-26)38-39-29-17-25-24-16-21(31(41)35-22-18-32(2,3)40(42)33(4,5)19-22)13-14-28(24)37-30(25)23-10-6-7-12-27(23)36-29/h6-16,22,25,30,37H,17-19H2,1-5H3,(H,35,41)(H,36,39)/b38-20+.
What are the key properties of CID 72737113?
CID 72737113 has a molecular weight of 564.71 g/mol, XLogP of 5.88, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72737113 is sourced from PubChem (CID 72737113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).