About methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate
methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate (PubChem CID 72737260) has the molecular formula C13H10F3NO4
and a molecular weight of 301.22 g/mol. Its IUPAC name is methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate |
| PubChem CID | 72737260 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)[C@](O)(c1c[nH]c2ccc(C=O)cc12)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO4/c1-21-11(19)12(20,13(14,15)16)9-5-17-10-3-2-7(6-18)4-8(9)10/h2-6,17,20H,1H3/t12-/m1/s1 |
| InChIKey | UBBAPRGNNWWSLJ-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate?
The IUPAC name of methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate (CID 72737260) is methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate.
What is the SMILES notation for methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate?
The canonical SMILES for methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate is COC(=O)[C@](O)(c1c[nH]c2ccc(C=O)cc12)C(F)(F)F.
What is the InChIKey of methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate?
The InChIKey is UBBAPRGNNWWSLJ-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H10F3NO4/c1-21-11(19)12(20,13(14,15)16)9-5-17-10-3-2-7(6-18)4-8(9)10/h2-6,17,20H,1H3/t12-/m1/s1.
What are the key properties of methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate?
methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate has a molecular weight of 301.22 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3,3,3-trifluoro-2-(5-formyl-1H-indol-3-yl)-2-hydroxypropanoate is sourced from PubChem (CID 72737260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).