About 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol
1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol (PubChem CID 72737276) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol |
| PubChem CID | 72737276 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol |
| SMILES | OC1(C=C=CC2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C15H24O/c16-15(11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h10,13-14,16H,1-6,8-9,11-12H2 |
| InChIKey | BQSUMXYFLKLWFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol?
The IUPAC name of 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol (CID 72737276) is 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol?
The canonical SMILES for 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol is OC1(C=C=CC2CCCCC2)CCCCC1.
What is the InChIKey of 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol?
The InChIKey is BQSUMXYFLKLWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c16-15(11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h10,13-14,16H,1-6,8-9,11-12H2.
What are the key properties of 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol?
1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol has a molecular weight of 220.36 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclohexylpropa-1,2-dienyl)cyclohexan-1-ol is sourced from PubChem (CID 72737276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).