About CID 72737331
CID 72737331 (PubChem CID 72737331) has the molecular formula C28H31NO4
and a molecular weight of 445.56 g/mol.
Molecular Properties
| Compound Name | CID 72737331 |
| PubChem CID | 72737331 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CN1c2ccccc2C2(OOC23C2CC4CC(C2)CC3C4)c2c(C)cccc21 |
| InChI | InChI=1S/C28H31NO4/c1-3-31-25(30)16-29-23-9-5-4-8-22(23)28(26-17(2)7-6-10-24(26)29)27(32-33-28)20-12-18-11-19(14-20)15-21(27)13-18/h4-10,18-21H,3,11-16H2,1-2H3 |
| InChIKey | ZHNKVOILYDJJCS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 72737331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72737331?
The IUPAC name of CID 72737331 (CID 72737331) is not available.
What is the SMILES notation for CID 72737331?
The canonical SMILES for CID 72737331 is CCOC(=O)CN1c2ccccc2C2(OOC23C2CC4CC(C2)CC3C4)c2c(C)cccc21.
What is the InChIKey of CID 72737331?
The InChIKey is ZHNKVOILYDJJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO4/c1-3-31-25(30)16-29-23-9-5-4-8-22(23)28(26-17(2)7-6-10-24(26)29)27(32-33-28)20-12-18-11-19(14-20)15-21(27)13-18/h4-10,18-21H,3,11-16H2,1-2H3.
What are the key properties of CID 72737331?
CID 72737331 has a molecular weight of 445.56 g/mol, XLogP of 5.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72737331 is sourced from PubChem (CID 72737331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).