C29H29N5O8 — CID 72737414
9-[2-[3,4-bis(3,4-dimethoxyphenyl)-2,5-dioxopyrrol-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 72737414) has the molecular formula C29H29N5O8 and a molecular weight of 575.58 g/mol. Its IUPAC name is 9-[2-[3,4-bis(3,4-dimethoxyphenyl)-2,5-dioxopyrrol-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 9-[2-[3,4-bis(3,4-dimethoxyphenyl)-2,5-dioxopyrrol-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 72737414 |
| Molecular Formula | C29H29N5O8 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 9-[2-[3,4-bis(3,4-dimethoxyphenyl)-2,5-dioxopyrrol-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(C2=C(c3ccc(OC)c(OC)c3)C(=O)N(CCn3cnc4c(=O)n(C)c(=O)n(C)c43)C2=O)cc1OC |
| InChI | InChI=1S/C29H29N5O8/c1-31-25-24(28(37)32(2)29(31)38)30-15-33(25)11-12-34-26(35)22(16-7-9-18(39-3)20(13-16)41-5)23(27(34)36)17-8-10-19(40-4)21(14-17)42-6/h7-10,13-15H,11-12H2,1-6H3 |
| InChIKey | QEZSFAOJYRIYHM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 136.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|