C10H13NO — CID 72739618
N-[(2,4,5-trimethylphenyl)methylidene]hydroxylamine (PubChem CID 72739618) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[(2,4,5-trimethylphenyl)methylidene]hydroxylamine.
| Compound Name | N-[(2,4,5-trimethylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 72739618 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-[(2,4,5-trimethylphenyl)methylidene]hydroxylamine |
| SMILES | Cc1cc(C)c(C=NO)cc1C |
| InChI | InChI=1S/C10H13NO/c1-7-4-9(3)10(6-11-12)5-8(7)2/h4-6,12H,1-3H3 |
| InChIKey | VKVOHEWMMQBPMJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|