C18H14N4O4S — CID 7274352
(5R,10bS)-9-nitro-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 7274352) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is (5R,10bS)-9-nitro-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5R,10bS)-9-nitro-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 7274352 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (5R,10bS)-9-nitro-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1N[C@@]2(CS1)Oc1ccc([N+](=O)[O-])cc1[C@@H]1CC(c3ccccc3)=NN12 |
| InChI | InChI=1S/C18H14N4O4S/c23-17-19-18(10-27-17)21-15(9-14(20-21)11-4-2-1-3-5-11)13-8-12(22(24)25)6-7-16(13)26-18/h1-8,15H,9-10H2,(H,19,23)/t15-,18+/m0/s1 |
| InChIKey | KYHORIBEIFAIAF-MAUKXSAKSA-N |
| XLogP | 3.25 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|